cas: 864759-67-1 — see every product listed under this CAS number, including other names
(3-Methyl-4-(trifluoromethyl)phenyl)boronic acid, 98% (CAS 864759-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330129-100MG |
| cas | 864759-67-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 378.01 Pln | |
| Fluorochem | 5g | 1497.41 Pln | |
| Fluorochem | 10g | 2934.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[3-methyl-4-(trifluoromethyl)phenyl]boronic acid (CAS 864759-67-1) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [3-methyl-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: WYIPXMTWQBAPEE-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [3-methyl-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WYIPXMTWQBAPEE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)