CAS 850411-13-1 appears in our catalog under these names: 3-Methyl-5-trifluoromethylphenylboronic acid, 98%, (3-Methyl-5-(trifluoromethyl)phenyl)boronic acid, 98%, 3-Methyl-5-trifluoromethylphenylboronic acid, 98%, 98%, (3-Methyl-5-(trifluoromethyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
[3-methyl-5-(trifluoromethyl)phenyl]boronic acid (CAS 850411-13-1) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [3-methyl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: ZZLZUGHSZSVQMK-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [3-methyl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | ZZLZUGHSZSVQMK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(F)(F)F)C)(O)O |
Computed by PubChem (NCBI)