cas: 341529-34-8 — see every product listed under this CAS number, including other names
(3-Nitro-phenyl)-piperazin-1-yl-methanone (CAS 341529-34-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F019626-250MG |
| cas | 341529-34-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 1997.23 Pln |
| delivery time | 2-3 weeks |
|---|
(3-nitrophenyl)-piperazin-1-ylmethanone (CAS 341529-34-8) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: (3-nitrophenyl)-piperazin-1-ylmethanone. InChIKey: RTCPOEOGSICKJP-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | (3-nitrophenyl)-piperazin-1-ylmethanone |
| InChIKey | RTCPOEOGSICKJP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)