CAS 1144447-35-7 is the registry number for 3-(5,7-Dimethyl-2-oxo-1,2-dihydropyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid (CAS 1144447-35-7) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: 3-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid. InChIKey: SBGWVFWDRJOBGJ-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 3-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid |
| InChIKey | SBGWVFWDRJOBGJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=CC(=O)NN12)C)CCC(=O)O |
Computed by PubChem (NCBI)