Products 956779-68-3
CAS 956779-68-3 appears in our catalog under these names: 3-Amino-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione, 3-Amino-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 10g, 250mg, 1g, 100mg.
3-amino-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione (CAS 956779-68-3) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: 3-amino-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione. InChIKey: RLFHBFXSPXIAJK-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 3-amino-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | RLFHBFXSPXIAJK-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)N)C2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)