CAS 1006459-06-8 appears in our catalog under these names: 5-(1-Ethyl-3,5-dimethyl-1h-pyrazol-4-yl)isoxazole-3-carboxylic acid, 95%, 5-(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)isoxazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid (CAS 1006459-06-8) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: SMXOIFNREBPGJC-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | SMXOIFNREBPGJC-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)C2=CC(=NO2)C(=O)O)C |
Computed by PubChem (NCBI)