cas: 1246765-28-5 — see every product listed under this CAS number, including other names
(3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)boronic acid 95% (CAS 1246765-28-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A101101-100mg |
| cas | 1246765-28-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 459.38 Pln | |
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1911.19 Pln | |
| Ambeed | 5g | 7445.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A101101 |
(3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid (CAS 1246765-28-5) is a chemical compound with the molecular formula C8H8BNO4 and a molecular weight of 192.97 g/mol. IUPAC name: (3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid. InChIKey: UWJIVYCLHMPFPZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO4 |
|---|---|
| Molecular weight | 192.97 g/mol |
| IUPAC name | (3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid |
| InChIKey | UWJIVYCLHMPFPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCC(=O)N2)(O)O |
Computed by PubChem (NCBI)