cas: 1246765-28-5 — see every product listed under this CAS number, including other names
(3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)boronic acid, 95% (CAS 1246765-28-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227519-100MG |
| cas | 1246765-28-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 1065.27 Pln | |
| Fluorochem | 5g | 5110.72 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid (CAS 1246765-28-5) is a chemical compound with the molecular formula C8H8BNO4 and a molecular weight of 192.97 g/mol. IUPAC name: (3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid. InChIKey: UWJIVYCLHMPFPZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO4 |
|---|---|
| Molecular weight | 192.97 g/mol |
| IUPAC name | (3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid |
| InChIKey | UWJIVYCLHMPFPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCC(=O)N2)(O)O |
Computed by PubChem (NCBI)