CAS 1246765-28-5 appears in our catalog under these names: 3-Oxo-3,4-dihydro-2h-benzo[b][1,4]oxazin-6-ylboronic acid, 95%, (3-Oxo-3,4-dihydro-2H-benzo(b)(1,4)oxazin-6-yl)boronic acid, 95-<97%, (3–Oxo–3,4–dihydro–2H–benzo(b)(1,4)oxazin–6–yl)boronic acid, (3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)boronic acid 95%, (3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-6-yl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 2,5g, 10g, 25g.
(3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid (CAS 1246765-28-5) is a chemical compound with the molecular formula C8H8BNO4 and a molecular weight of 192.97 g/mol. IUPAC name: (3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid. InChIKey: UWJIVYCLHMPFPZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO4 |
|---|---|
| Molecular weight | 192.97 g/mol |
| IUPAC name | (3-oxo-4H-1,4-benzoxazin-6-yl)boronic acid |
| InChIKey | UWJIVYCLHMPFPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCC(=O)N2)(O)O |
Computed by PubChem (NCBI)