Products 216394-04-6
CAS 216394-04-6 is the registry number for 4-(E-2-Nitrovinyl)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
[4-[(E)-2-nitroethenyl]phenyl]boronic acid (CAS 216394-04-6) is a chemical compound with the molecular formula C8H8BNO4 and a molecular weight of 192.97 g/mol. IUPAC name: [4-[(E)-2-nitroethenyl]phenyl]boronic acid. InChIKey: GMEGTAODWQPCOD-AATRIKPKSA-N.
| Molecular formula | C8H8BNO4 |
|---|---|
| Molecular weight | 192.97 g/mol |
| IUPAC name | [4-[(E)-2-nitroethenyl]phenyl]boronic acid |
| InChIKey | GMEGTAODWQPCOD-AATRIKPKSA-N |
| SMILES | B(C1=CC=C(C=C1)/C=C/[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)
Synonyms:
(E)-(4-(2-Nitrovinyl)phenyl)boronic acid, 4-(2-Nitrovinyl)phenylboronic acid, [4-[(E)-2-nitroethenyl]phenyl]boronic acid, 4-(2-Nitrovinyl)phenylboronicAcid, {4-[(1E)-2-nitroethenyl]phenyl}boronic acid, {4-[(E)-2-nitroethenyl]phenyl}boronic acid, 4-[(E)-2-Nitrovinyl]benzeneboronic acid, 4-(E-2-Nitrovinyl)phenylboronic acid, [4-[(E)-2-nitrovinyl]phenyl]boronic acid, {4-[(E)-2-Nitroethen-1-yl]phenyl}boronic acid