Products 98555-37-4
CAS 98555-37-4 appears in our catalog under these names: 4–(2–Nitrovinyl)phenylboronic Acid, 4-(2-Nitrovinyl)phenylboronic Acid, ≥95%, ≥95%. Offered by: GLPBio, Chemat. Available pack sizes: 250mg, 50mg, 100mg, 1g.
[4-[(E)-2-nitroethenyl]phenyl]boronic acid (CAS 98555-37-4) is a chemical compound with the molecular formula C8H8BNO4 and a molecular weight of 192.97 g/mol. IUPAC name: [4-[(E)-2-nitroethenyl]phenyl]boronic acid. InChIKey: GMEGTAODWQPCOD-AATRIKPKSA-N.
| Molecular formula | C8H8BNO4 |
|---|---|
| Molecular weight | 192.97 g/mol |
| IUPAC name | [4-[(E)-2-nitroethenyl]phenyl]boronic acid |
| InChIKey | GMEGTAODWQPCOD-AATRIKPKSA-N |
| SMILES | B(C1=CC=C(C=C1)/C=C/[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)
Synonyms:
(E)-(4-(2-Nitrovinyl)phenyl)boronic acid, 4-(2-Nitrovinyl)phenylboronic acid, [4-[(E)-2-nitroethenyl]phenyl]boronic acid, 4-(2-Nitrovinyl)phenylboronicAcid, {4-[(1E)-2-nitroethenyl]phenyl}boronic acid, {4-[(E)-2-nitroethenyl]phenyl}boronic acid, 4-[(E)-2-Nitrovinyl]benzeneboronic acid, 4-(E-2-Nitrovinyl)phenylboronic acid, [4-[(E)-2-nitrovinyl]phenyl]boronic acid, {4-[(E)-2-Nitroethen-1-yl]phenyl}boronic acid