(3-Phenylnaphthalen-1-yl)boronic acid, 95%
cas: 1922905-62-1 — see every product listed under this CAS number, including other names
(3-Phenylnaphthalen-1-yl)boronic acid, 95% (CAS 1922905-62-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1505885-250mg |
| cas | 1922905-62-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1710.94 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 462.80 Pln | |
| Chemat | 5g | 1466.00 Pln | |
| BLDpharm | 250mg | 286.59 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1836.04 Pln | |
| Fluorochem | 1g | 836.18 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(3-phenylnaphthalen-1-yl)boronic acid (CAS 1922905-62-1) is a chemical compound with the molecular formula C16H13BO2 and a molecular weight of 248.1 g/mol. IUPAC name: (3-phenylnaphthalen-1-yl)boronic acid. InChIKey: JCXIXVOTTRHVQT-UHFFFAOYSA-N.
| Molecular formula | C16H13BO2 |
|---|---|
| Molecular weight | 248.1 g/mol |
| IUPAC name | (3-phenylnaphthalen-1-yl)boronic acid |
| InChIKey | JCXIXVOTTRHVQT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC2=CC=CC=C12)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)