cas: 349-82-6 — see every product listed under this CAS number, including other names
(3-Trifluoromethyl-phenoxy)-acetic acid (CAS 349-82-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 10g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F060152-100MG |
| cas | 349-82-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 10g | 4475.53 Pln | |
| Fluorochem | 1g | 976.76 Pln | |
| Fluorochem | 5g | 2668.87 Pln |
| delivery time | 3-4 weeks |
|---|
2-[3-(trifluoromethyl)phenoxy]acetic acid (CAS 349-82-6) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenoxy]acetic acid. InChIKey: KTTDWGZRVMNQNZ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenoxy]acetic acid |
| InChIKey | KTTDWGZRVMNQNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)