CAS 937068-58-1 appears in our catalog under these names: 2-Methoxy-3-(trifluoromethyl)benzoic acid, 97%, 2-Methoxy-3-(trifluoromethyl)benzoic acid, 98%, 2-Methoxy-3-(trifluoromethyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 5g.
2-methoxy-3-(trifluoromethyl)benzoic acid (CAS 937068-58-1) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2-methoxy-3-(trifluoromethyl)benzoic acid. InChIKey: COVAZHQHYXQLOT-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-methoxy-3-(trifluoromethyl)benzoic acid |
| InChIKey | COVAZHQHYXQLOT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)