CAS 349-82-6 appears in our catalog under these names: [3-(Trifluoromethyl)phenoxy]acetic acid, 97%, Travoprost Impurity 8, (3-Trifluoromethyl-phenoxy)-acetic acid, 95%, 2-(3-(Trifluoromethyl)phenoxy)acetic acid, 97%. Offered by: Combi-blocks, Chemat Brand, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, on request, 100mg, 250mg, 10g.
2-[3-(trifluoromethyl)phenoxy]acetic acid (CAS 349-82-6) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenoxy]acetic acid. InChIKey: KTTDWGZRVMNQNZ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenoxy]acetic acid |
| InChIKey | KTTDWGZRVMNQNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)