CAS 51359-73-0 appears in our catalog under these names: (R)-(3-Trifluoromethyl)mandelic acid, 95%, (R)-2-Hydroxy-2-(3-(trifluoromethyl)phenyl)acetic acid, 97%, (R)–(3–TRIFLUOROMETHYL)MANDELIC ACID. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg.
(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetic acid (CAS 51359-73-0) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: (2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetic acid. InChIKey: WECBNRQPNXNRSJ-SSDOTTSWSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | (2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | WECBNRQPNXNRSJ-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)[C@H](C(=O)O)O |
Computed by PubChem (NCBI)