cas: 75172-31-5 — see every product listed under this CAS number, including other names
(3R,4R)-(-)-1-Benzyl-3,4-dihydroxypyrrolidine-2,5-dione (CAS 75172-31-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300731-100MG |
| cas | 75172-31-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 685.19 Pln |
| delivery time | 3-4 weeks |
|---|
(3R,4R)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione (CAS 75172-31-5) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: (3R,4R)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione. InChIKey: IZBMPGFJNIDMRR-RKDXNWHRSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | (3R,4R)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione |
| InChIKey | IZBMPGFJNIDMRR-RKDXNWHRSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)[C@@H]([C@H](C2=O)O)O |
Computed by PubChem (NCBI)