Products 143815-47-8
CAS 143815-47-8 appears in our catalog under these names: (E)-2-Acetamido-3-(3-hydroxyphenyl)acrylic acid, 95%, (E)-2-Acetamido-3-(3-hydroxyphenyl)acrylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 100g, 25g, 1g.
(E)-2-acetamido-3-(3-hydroxyphenyl)prop-2-enoic acid (CAS 143815-47-8) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: (E)-2-acetamido-3-(3-hydroxyphenyl)prop-2-enoic acid. InChIKey: DDLOBOOFCSYTKW-UXBLZVDNSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | (E)-2-acetamido-3-(3-hydroxyphenyl)prop-2-enoic acid |
| InChIKey | DDLOBOOFCSYTKW-UXBLZVDNSA-N |
| SMILES | CC(=O)N/C(=C/C1=CC(=CC=C1)O)/C(=O)O |
Computed by PubChem (NCBI)