CAS 1017273-27-6 is the registry number for Methyl 4-methyl-3-oxo-3,4-dihydro-2h-1,4-benzoxazine-8-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-methyl-3-oxo-1,4-benzoxazine-8-carboxylate (CAS 1017273-27-6) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: methyl 4-methyl-3-oxo-1,4-benzoxazine-8-carboxylate. InChIKey: UVYQPYVFLNZDDX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | methyl 4-methyl-3-oxo-1,4-benzoxazine-8-carboxylate |
| InChIKey | UVYQPYVFLNZDDX-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C(C=CC=C21)C(=O)OC |
Computed by PubChem (NCBI)