CAS 1038478-70-4 is the registry number for Ethyl 3-oxo-3,4-dihydro-2h-1,4-benzoxazine-7-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 3-oxo-4H-1,4-benzoxazine-7-carboxylate (CAS 1038478-70-4) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: ethyl 3-oxo-4H-1,4-benzoxazine-7-carboxylate. InChIKey: JZGBQEHYAMKOST-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | ethyl 3-oxo-4H-1,4-benzoxazine-7-carboxylate |
| InChIKey | JZGBQEHYAMKOST-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=O)CO2 |
Computed by PubChem (NCBI)