CAS 1354486-07-9 appears in our catalog under these names: (3S,4S)–1–benzyl–N,4–dimethylpiperidin–3–amine,dihydrochloride, (3S,4S)-1-Benzyl-N,4-dimethylpiperidin-3-amine dihydrochloride, 98%, 98%, (3S,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine dihydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg.
(3S,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride (CAS 1354486-07-9) is a chemical compound with the molecular formula C14H24Cl2N2 and a molecular weight of 291.3 g/mol. IUPAC name: (3S,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride. InChIKey: CVQNXCBXFOIHLH-CIKMBUIBSA-N.
| Molecular formula | C14H24Cl2N2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | (3S,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride |
| InChIKey | CVQNXCBXFOIHLH-CIKMBUIBSA-N |
| SMILES | C[C@H]1CCN(C[C@H]1NC)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)