CAS 477600-68-3 appears in our catalog under these names: cis-1-Benzyl-N-methyl-4-methylpiperidin-3-amine dihydrochloride, 98%, 98%, (3S,4S)-1-BENZYL-N,4-DIMETHYLPIPERIDIN-3-AMINE HCL. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
(3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride (CAS 477600-68-3) is a chemical compound with the molecular formula C14H24Cl2N2 and a molecular weight of 291.3 g/mol. IUPAC name: (3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride. InChIKey: CVQNXCBXFOIHLH-DAIKJZOUSA-N.
| Molecular formula | C14H24Cl2N2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | (3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride |
| InChIKey | CVQNXCBXFOIHLH-DAIKJZOUSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1NC)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)