cas: 1949-89-9 — see every product listed under this CAS number, including other names
(3R,4R,5R)-3,4,5,6-Tetrahydroxyhexanal, 98%, 98% (CAS 1949-89-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I441-100mg |
| cas | 1949-89-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 885.20 Pln | |
| Chemat | 10g | 1710.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-deoxy-D-galactose is a deoxygalactose. It is functionally related to a D-galactose and an aldehydo-D-galactose.
Source: ChEBI
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (3R,4R,5R)-3,4,5,6-tetrahydroxyhexanal |
| InChIKey | VRYALKFFQXWPIH-HSUXUTPPSA-N |
| SMILES | C(C=O)[C@H]([C@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)