cas: 1949-89-9 — see every product listed under this CAS number, including other names
2-Deoxy-D-galactose, 98.00% (CAS 1949-89-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM55720C-10g |
| cas | 1949-89-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1807.52 Pln | |
| Chemat | 1g | 339.13 Pln | |
| Chemat | 2g | 548.83 Pln | |
| Chemat | 5g | 1052.23 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
2-deoxy-D-galactose is a deoxygalactose. It is functionally related to a D-galactose and an aldehydo-D-galactose.
Source: ChEBI
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (3R,4R,5R)-3,4,5,6-tetrahydroxyhexanal |
| InChIKey | VRYALKFFQXWPIH-HSUXUTPPSA-N |
| SMILES | C(C=O)[C@H]([C@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)