cas: 1255935-12-6 — see every product listed under this CAS number, including other names
(3R,4S)-rel-1-(tert-Butoxycarbonyl)-4-(pyridin-4-yl)pyrrolidine-3-carboxylic acid, 98+% (CAS 1255935-12-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A702891-1g |
| cas | 1255935-12-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 5141.29 Pln | |
| AmBeed | 250mg | 1756.09 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-pyridin-4-ylpyrrolidine-3-carboxylic acid (CAS 1255935-12-6) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: (3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-pyridin-4-ylpyrrolidine-3-carboxylic acid. InChIKey: MFBDFVFXHFCNQX-NEPJUHHUSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | (3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-pyridin-4-ylpyrrolidine-3-carboxylic acid |
| InChIKey | MFBDFVFXHFCNQX-NEPJUHHUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)