Products 1177283-46-3
CAS 1177283-46-3 appears in our catalog under these names: 2-(2,5,7-Trimethyl-1h-indol-3-yl)ethanamine oxalate, 95%, 2-(2,5,7-Trimethyl-1H-indol-3-yl)ethanamine oxalate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 500mg.
Oxalic acid;2-(2,5,7-trimethyl-1H-indol-3-yl)ethanamine (CAS 1177283-46-3) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: oxalic acid;2-(2,5,7-trimethyl-1H-indol-3-yl)ethanamine. InChIKey: CEUITYWUARUWNY-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | oxalic acid;2-(2,5,7-trimethyl-1H-indol-3-yl)ethanamine |
| InChIKey | CEUITYWUARUWNY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=C(N2)C)CCN)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)