CAS 115655-42-0 appears in our catalog under these names: 1-Benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate, 95%, 1-Benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate, 97%, 1–Benzyl 4–methyl 4–aminopiperidine–1,4–dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 500mg.
1-O-benzyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate (CAS 115655-42-0) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: 1-O-benzyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate. InChIKey: PLQPYSJTFRDBOT-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 1-O-benzyl 4-O-methyl 4-aminopiperidine-1,4-dicarboxylate |
| InChIKey | PLQPYSJTFRDBOT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCN(CC1)C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)