Products 1820609-00-4

CAS 1820609-00-4 is the registry number for [2-(3-Formyl-benzoylamino)-ethyl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-[(3-formylbenzoyl)amino]ethyl]carbamate (CAS 1820609-00-4) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: tert-butyl N-[2-[(3-formylbenzoyl)amino]ethyl]carbamate. InChIKey: SYMBGDBRUSTYBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20N2O4
Molecular weight292.33 g/mol
IUPAC nametert-butyl N-[2-[(3-formylbenzoyl)amino]ethyl]carbamate
InChIKeySYMBGDBRUSTYBZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCNC(=O)C1=CC=CC(=C1)C=O

Computed by PubChem (NCBI)