cas: 1217774-23-6 — see every product listed under this CAS number, including other names
(3R,4R)-rel-Methyl 4-((tert-butoxycarbonyl)amino)piperidine-3-carboxylate, 95%, 95% (CAS 1217774-23-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126YD-1g |
| cas | 1217774-23-6 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1446.80 Pln | |
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 630.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate (CAS 1217774-23-6) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: methyl (3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate. InChIKey: JZMRLHYTQICGLN-IUCAKERBSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | methyl (3S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate |
| InChIKey | JZMRLHYTQICGLN-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCNC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)