CAS 1217684-50-8 appears in our catalog under these names: Cis-4-boc-amino-piperidine-3-carboxylic acid methyl ester, 97%, cis-Methyl 4-((tert-butoxycarbonyl)amino)piperidine-3-carboxylate, 98%, cis-Methyl 4-((tert-butoxycarbonyl)amino)piperidine-3-carboxylate, 97%, 97%, cis-4-Boc-Amino-piperidine-3-carboxylic acid methyl ester, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg.
Methyl (3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate (CAS 1217684-50-8) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: methyl (3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate. InChIKey: JZMRLHYTQICGLN-DTWKUNHWSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | methyl (3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-3-carboxylate |
| InChIKey | JZMRLHYTQICGLN-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)