CAS 247175-69-5 appears in our catalog under these names: (2S,3S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-phenylbutanoic acid, 98%, (2S,3S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-phenylbutanoic acid, 98%, 98%, Fmoc-(2S,3S)-2-amino-3-phenylbutanoic acid, 98%, (3S)-Fmoc-3-Me-Phe-OH, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylbutanoic acid (CAS 247175-69-5) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylbutanoic acid. InChIKey: ZQWJZRLWGALBIQ-HJPURHCSSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylbutanoic acid |
| InChIKey | ZQWJZRLWGALBIQ-HJPURHCSSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)