CAS 209252-16-4 appears in our catalog under these names: Fmoc-d-beta-homophenylalanine, 96%, Fmoc–D–β–Homophenylalanine, Fmoc-D-beta-HPhe-OH, Fmoc-D-β-HoPhe-OH 97%, (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-phenylbutanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg, 500mg.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid (CAS 209252-16-4) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid. InChIKey: DQNUGHJJKNFCND-GOSISDBHSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid |
| InChIKey | DQNUGHJJKNFCND-GOSISDBHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)