CAS 284492-06-4 appears in our catalog under these names: N-Fmoc-3-amino-3-m-tolyl-propionic acid, 95%, Fmoc–3–amino–3–(3–methylphenyl)–propionicacid, Fmoc-3-amino-3-(3-methylphenyl)-propionic acid 98%, Benzenepropanoic acid, b-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-3-methyl-, 98%, 98%, Fmoc-3-amino-3-(3-methylphenyl)-propionic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylphenyl)propanoic acid (CAS 284492-06-4) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylphenyl)propanoic acid. InChIKey: QDIMUVCWIVIKLY-UHFFFAOYSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methylphenyl)propanoic acid |
| InChIKey | QDIMUVCWIVIKLY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)