CAS 1858223-89-8 appears in our catalog under these names: (R)-4-(Fmoc-amino)-3-phenylbutyric acid, 95%, Fmoc-(R)-Pga-OH. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 5g, 250mg, 1g, 25g.
(3R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylbutanoic acid (CAS 1858223-89-8) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (3R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylbutanoic acid. InChIKey: XALWLSKRFCZNFL-SFHVURJKSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (3R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylbutanoic acid |
| InChIKey | XALWLSKRFCZNFL-SFHVURJKSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CC(=O)O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)