cas: 1147112-69-3 — see every product listed under this CAS number, including other names
(3S,4R)-3-FLUORO-4-PIPERIDINOL HCL, 97% (CAS 1147112-69-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468279-100MG |
| cas | 1147112-69-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 924.69 Pln | |
| Fluorochem | 250mg | 1445.34 Pln | |
| Fluorochem | 1g | 3501.91 Pln | |
| Fluorochem | 5g | 15138.44 Pln | |
| Fluorochem | 10g | 25192.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S,4R)-3-fluoropiperidin-4-ol;hydrochloride (CAS 1147112-69-3) is a chemical compound with the molecular formula C5H11ClFNO and a molecular weight of 155.60 g/mol. IUPAC name: (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride. InChIKey: VGRYZBPWUNRGDD-UYXJWNHNSA-N.
| Molecular formula | C5H11ClFNO |
|---|---|
| Molecular weight | 155.60 g/mol |
| IUPAC name | (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride |
| InChIKey | VGRYZBPWUNRGDD-UYXJWNHNSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1O)F.Cl |
Computed by PubChem (NCBI)