Products 1443380-89-9
CAS 1443380-89-9 is the registry number for (3S,4R)-3-Fluoropiperidin-4-ol hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg.
(3S,4R)-3-fluoropiperidin-4-ol;hydrochloride (CAS 1443380-89-9) is a chemical compound with the molecular formula C5H11ClFNO and a molecular weight of 155.60 g/mol. IUPAC name: (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride. InChIKey: VGRYZBPWUNRGDD-UYXJWNHNSA-N.
| Molecular formula | C5H11ClFNO |
|---|---|
| Molecular weight | 155.60 g/mol |
| IUPAC name | (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride |
| InChIKey | VGRYZBPWUNRGDD-UYXJWNHNSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1O)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3S,4R)-3-fluoropiperidin-4-ol hydrochloride, (3S,4R)-3-Fluoro-4-piperidinol hydrochloride, (3S,4R)-3-Fluoro-4-piperidinol HCl, (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride, cis-3-fluoropiperidin-4-ol hydrochloride, (3S,4R)-3-Fluoro-4-hydroxypiperidine HCl, (3S,4R)-3-fluoropiperidin-4-olhydrochloride