(3S,4R)-3-Fluoropiperidin-4-ol hydrochloride, 97%
cas: 1443380-89-9 — see every product listed under this CAS number, including other names
(3S,4R)-3-Fluoropiperidin-4-ol hydrochloride, 97% (CAS 1443380-89-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A147749-100mg |
| cas | 1443380-89-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 670.75 Pln | |
| Ambeed | 250mg | 1176.94 Pln | |
| Ambeed | 1g | 2506.38 Pln | |
| Ambeed | 5g | 8363.69 Pln | |
| Ambeed | 10g | 13898.38 Pln | |
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1269.20 Pln | |
| Chemat | 5g | 4658.00 Pln | |
| Chemat | 10g | 9016.40 Pln | |
| BLDpharm | 100mg | 719.77 Pln | |
| BLDpharm | 250mg | 1264.02 Pln | |
| BLDpharm | 1g | 2696.85 Pln | |
| BLDpharm | 5g | 9011.30 Pln | |
| BLDpharm | 10g | 14981.42 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(3S,4R)-3-fluoropiperidin-4-ol;hydrochloride (CAS 1443380-89-9) is a chemical compound with the molecular formula C5H11ClFNO and a molecular weight of 155.60 g/mol. IUPAC name: (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride. InChIKey: VGRYZBPWUNRGDD-UYXJWNHNSA-N.
| Molecular formula | C5H11ClFNO |
|---|---|
| Molecular weight | 155.60 g/mol |
| IUPAC name | (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride |
| InChIKey | VGRYZBPWUNRGDD-UYXJWNHNSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1O)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3S,4R)-3-fluoropiperidin-4-ol hydrochloride, (3S,4R)-3-Fluoro-4-piperidinol hydrochloride, (3S,4R)-3-Fluoro-4-piperidinol HCl, (3S,4R)-3-fluoropiperidin-4-ol;hydrochloride, cis-3-fluoropiperidin-4-ol hydrochloride, (3S,4R)-3-Fluoro-4-hydroxypiperidine HCl, (3S,4R)-3-fluoropiperidin-4-olhydrochloride