cas: 1049740-23-9 — see every product listed under this CAS number, including other names
(3S,4R)-4-(Pyridin-4-yl)pyrrolidine-3-carboxylic acid dihydrochloride, 95+% (CAS 1049740-23-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A495214-250mg |
| cas | 1049740-23-9 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 2439.64 Pln | |
| AmBeed | 100mg | 1254.82 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S,4R)-4-pyridin-4-ylpyrrolidine-3-carboxylic acid;dihydrochloride (CAS 1049740-23-9) is a chemical compound with the molecular formula C10H14Cl2N2O2 and a molecular weight of 265.13 g/mol. IUPAC name: (3S,4R)-4-pyridin-4-ylpyrrolidine-3-carboxylic acid;dihydrochloride. InChIKey: GUMWLQDUMJSNQW-DBEJOZALSA-N.
| Molecular formula | C10H14Cl2N2O2 |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | (3S,4R)-4-pyridin-4-ylpyrrolidine-3-carboxylic acid;dihydrochloride |
| InChIKey | GUMWLQDUMJSNQW-DBEJOZALSA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(=O)O)C2=CC=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)