Products 2525094-63-5

CAS 2525094-63-5 is the registry number for Methyl 6-(1-aminocyclopropyl)nicotinate dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 6-(1-aminocyclopropyl)pyridine-3-carboxylate;dihydrochloride (CAS 2525094-63-5) is a chemical compound with the molecular formula C10H14Cl2N2O2 and a molecular weight of 265.13 g/mol. IUPAC name: methyl 6-(1-aminocyclopropyl)pyridine-3-carboxylate;dihydrochloride. InChIKey: WPXKRWALPFRTIV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14Cl2N2O2
Molecular weight265.13 g/mol
IUPAC namemethyl 6-(1-aminocyclopropyl)pyridine-3-carboxylate;dihydrochloride
InChIKeyWPXKRWALPFRTIV-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN=C(C=C1)C2(CC2)N.Cl.Cl

Computed by PubChem (NCBI)