CAS 2525094-63-5 is the registry number for Methyl 6-(1-aminocyclopropyl)nicotinate dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-(1-aminocyclopropyl)pyridine-3-carboxylate;dihydrochloride (CAS 2525094-63-5) is a chemical compound with the molecular formula C10H14Cl2N2O2 and a molecular weight of 265.13 g/mol. IUPAC name: methyl 6-(1-aminocyclopropyl)pyridine-3-carboxylate;dihydrochloride. InChIKey: WPXKRWALPFRTIV-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2O2 |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | methyl 6-(1-aminocyclopropyl)pyridine-3-carboxylate;dihydrochloride |
| InChIKey | WPXKRWALPFRTIV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(C=C1)C2(CC2)N.Cl.Cl |
Computed by PubChem (NCBI)