CAS 1263378-85-3 appears in our catalog under these names: Methyl 5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate dihydrochloride, 97%, Methyl 5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate dihydrochloride, 97%, 97%, 5,6,7,8-Tetrahydro-[1,6]naphthyridine-3-carboxylic acid methyl ester dihydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg.
Methyl 5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate;dihydrochloride (CAS 1263378-85-3) is a chemical compound with the molecular formula C10H14Cl2N2O2 and a molecular weight of 265.13 g/mol. IUPAC name: methyl 5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate;dihydrochloride. InChIKey: KJBAAUVHJJAWHH-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2O2 |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | methyl 5,6,7,8-tetrahydro-1,6-naphthyridine-3-carboxylate;dihydrochloride |
| InChIKey | KJBAAUVHJJAWHH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CCNC2)N=C1.Cl.Cl |
Computed by PubChem (NCBI)