CAS 2551116-71-1 appears in our catalog under these names: Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate dihydrochloride, 95%, 95%, Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate dihydrochloride, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate;dihydrochloride (CAS 2551116-71-1) is a chemical compound with the molecular formula C10H14Cl2N2O2 and a molecular weight of 265.13 g/mol. IUPAC name: methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate;dihydrochloride. InChIKey: OWFPEZOBUWMJEM-UHFFFAOYSA-N.
| Molecular formula | C10H14Cl2N2O2 |
|---|---|
| Molecular weight | 265.13 g/mol |
| IUPAC name | methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate;dihydrochloride |
| InChIKey | OWFPEZOBUWMJEM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CNCC2)N=C1.Cl.Cl |
Computed by PubChem (NCBI)