cas: 1049755-65-8 — see every product listed under this CAS number, including other names
(3S,4R)-4-Phenylpyrrolidine-3-carboxylic acid hydrochloride, 98%, 98% (CAS 1049755-65-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118FZ6-50mg |
| cas | 1049755-65-8 |
| size | 50mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 611.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S,4R)-4-phenylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1049755-65-8) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: (3S,4R)-4-phenylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: UDMOMQDXMDMSAV-BAUSSPIASA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | (3S,4R)-4-phenylpyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | UDMOMQDXMDMSAV-BAUSSPIASA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(=O)O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)