Products 1308311-57-0
CAS 1308311-57-0 appears in our catalog under these names: (S,E)-Methyl 2-amino-4-phenylbut-3-enoate hydrochloride, 95%, (S,E)-Methyl 2-amino-4-phenylbut-3-enoate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Methyl (E,2S)-2-amino-4-phenylbut-3-enoate;hydrochloride (CAS 1308311-57-0) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl (E,2S)-2-amino-4-phenylbut-3-enoate;hydrochloride. InChIKey: GZJHBNYDPJFPSC-RLIRWNGTSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl (E,2S)-2-amino-4-phenylbut-3-enoate;hydrochloride |
| InChIKey | GZJHBNYDPJFPSC-RLIRWNGTSA-N |
| SMILES | COC(=O)[C@H](/C=C/C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)