CAS 1049755-65-8 appears in our catalog under these names: (+/-)-Trans-4-phenyl-pyrrolidine-3-carboxylic acid hydrochloride, 98%, (3S,4R)-4-Phenylpyrrolidine-3-carboxylic acid hydrochloride, 98%, 98%, (3S,4R)-4-PHENYLPYRROLIDINE-3-CARBOXYLIC ACID HCL, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 50mg, 100mg.
(3S,4R)-4-phenylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1049755-65-8) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: (3S,4R)-4-phenylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: UDMOMQDXMDMSAV-BAUSSPIASA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | (3S,4R)-4-phenylpyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | UDMOMQDXMDMSAV-BAUSSPIASA-N |
| SMILES | C1[C@H]([C@@H](CN1)C(=O)O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)