cas: 90365-74-5 — see every product listed under this CAS number, including other names
(3S,4S)-(+)-1-Benzyl-3,4-pyrrolidindiol, 97% (CAS 90365-74-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 348730010 |
| cas | 90365-74-5 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 570.17 Pln | |
| Thermo Scientific (Acros) | 5g | 2022.32 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
(3S,4S)-1-benzylpyrrolidine-3,4-diol (CAS 90365-74-5) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (3S,4S)-1-benzylpyrrolidine-3,4-diol. InChIKey: QJRIUWQPJVPYSO-QWRGUYRKSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (3S,4S)-1-benzylpyrrolidine-3,4-diol |
| InChIKey | QJRIUWQPJVPYSO-QWRGUYRKSA-N |
| SMILES | C1[C@@H]([C@H](CN1CC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)