CAS 330152-66-4 is the registry number for rel-(3R,4R)-1-Benzylpyrrolidine-3,4-diol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3R,4R)-1-benzylpyrrolidine-3,4-diol (CAS 330152-66-4) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (3R,4R)-1-benzylpyrrolidine-3,4-diol. InChIKey: QJRIUWQPJVPYSO-GHMZBOCLSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (3R,4R)-1-benzylpyrrolidine-3,4-diol |
| InChIKey | QJRIUWQPJVPYSO-GHMZBOCLSA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)