cas: 90365-74-5 — see every product listed under this CAS number, including other names
(3S,4S)-1-Benzyl-pyrrolidin-3,4-diol, 97%, 97% (CAS 90365-74-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 50g, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AYB-10g |
| cas | 90365-74-5 |
| size | 10g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 434.00 Pln | |
| Chemat | 50g | 1638.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 251.60 Pln | |
| Chemat | 25g | 851.60 Pln | |
| Chemat | 100g | 3213.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S,4S)-1-benzylpyrrolidine-3,4-diol (CAS 90365-74-5) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (3S,4S)-1-benzylpyrrolidine-3,4-diol. InChIKey: QJRIUWQPJVPYSO-QWRGUYRKSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (3S,4S)-1-benzylpyrrolidine-3,4-diol |
| InChIKey | QJRIUWQPJVPYSO-QWRGUYRKSA-N |
| SMILES | C1[C@@H]([C@H](CN1CC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)