CAS 2376696-27-2 is the registry number for (3R,4S)-4-Fluorotetrahydrofuran-3-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-fluorooxolan-3-amine;hydrochloride (CAS 2376696-27-2) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3R,4S)-4-fluorooxolan-3-amine;hydrochloride. InChIKey: ZDRLKYGLYRTMMM-VKKIDBQXSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3R,4S)-4-fluorooxolan-3-amine;hydrochloride |
| InChIKey | ZDRLKYGLYRTMMM-VKKIDBQXSA-N |
| SMILES | C1[C@H]([C@@H](CO1)F)N.Cl |
Computed by PubChem (NCBI)