CAS 2227197-50-2 appears in our catalog under these names: (3S,4R)-4-Fluoropyrrolidin-3-ol hydrochloride, 97%, (3S,4R)-4-Fluoropyrrolidin-3-ol Hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
(3S,4R)-4-fluoropyrrolidin-3-ol;hydrochloride (CAS 2227197-50-2) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3S,4R)-4-fluoropyrrolidin-3-ol;hydrochloride. InChIKey: ZZJHCOUWDLIGPH-HJXLNUONSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3S,4R)-4-fluoropyrrolidin-3-ol;hydrochloride |
| InChIKey | ZZJHCOUWDLIGPH-HJXLNUONSA-N |
| SMILES | C1[C@@H]([C@@H](CN1)F)O.Cl |
Computed by PubChem (NCBI)