cas: 1203651-07-3 — see every product listed under this CAS number, including other names
(3S,5R)-3-(BOC-AMINO)-5-METHYLPIPERIDINE, 98% (CAS 1203651-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F502618-100MG |
| cas | 1203651-07-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 2226.32 Pln | |
| Fluorochem | 5g | 8468.91 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(3S,5R)-5-methylpiperidin-3-yl]carbamate (CAS 1203651-07-3) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(3S,5R)-5-methylpiperidin-3-yl]carbamate. InChIKey: CNALVHVMBXLLIY-BDAKNGLRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(3S,5R)-5-methylpiperidin-3-yl]carbamate |
| InChIKey | CNALVHVMBXLLIY-BDAKNGLRSA-N |
| SMILES | C[C@@H]1C[C@@H](CNC1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)